C32H54N2O3Sn — CID 11082735
tert-butyl (4R)-4-[(1S)-1-(benzylamino)-3-tributylstannylprop-2-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11082735) has the molecular formula C32H54N2O3Sn and a molecular weight of 633.51 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(1S)-1-(benzylamino)-3-tributylstannylprop-2-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(1S)-1-(benzylamino)-3-tributylstannylprop-2-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11082735 |
| Molecular Formula | C32H54N2O3Sn |
| Molecular Weight | 633.51 g/mol |
| Exact Mass | 634.32 |
| IUPAC Name | tert-butyl (4R)-4-[(1S)-1-(benzylamino)-3-tributylstannylprop-2-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCC[Sn](C#C[C@H](NCc1ccccc1)[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C20H27N2O3.3C4H9.Sn/c1-7-16(21-13-15-11-9-8-10-12-15)17-14-24-20(5,6)22(17)18(23)25-19(2,3)4;3*1-3-4-2;/h8-12,16-17,21H,13-14H2,2-6H3;3*1,3-4H2,2H3;/t16-,17-;;;;/m0..../s1 |
| InChIKey | GUSMMLZCUQCCGK-LWTACFFUSA-N |
| XLogP | 7.91 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.51 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|