C31H66O3SiSn — CID 11082739
tert-butyl-[(E,5S,11R)-11-(methoxymethoxy)-11-tributylstannylundec-9-en-5-yl]oxy-dimethylsilane (PubChem CID 11082739) has the molecular formula C31H66O3SiSn and a molecular weight of 633.66 g/mol. Its IUPAC name is tert-butyl-[(E,5S,11R)-11-(methoxymethoxy)-11-tributylstannylundec-9-en-5-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,5S,11R)-11-(methoxymethoxy)-11-tributylstannylundec-9-en-5-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11082739 |
| Molecular Formula | C31H66O3SiSn |
| Molecular Weight | 633.66 g/mol |
| Exact Mass | 634.38 |
| IUPAC Name | tert-butyl-[(E,5S,11R)-11-(methoxymethoxy)-11-tributylstannylundec-9-en-5-yl]oxy-dimethylsilane |
| SMILES | CCCC[C@@H](CCC/C=C/[C@H](OCOC)[Sn](CCCC)(CCCC)CCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H39O3Si.3C4H9.Sn/c1-8-9-14-18(22-23(6,7)19(2,3)4)15-12-10-11-13-16-21-17-20-5;3*1-3-4-2;/h11,13,16,18H,8-10,12,14-15,17H2,1-7H3;3*1,3-4H2,2H3;/b13-11+;;;;/t18-;;;;/m0..../s1 |
| InChIKey | QUGVUDPGVSCPHX-GZJRMLIHSA-N |
| XLogP | 10.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.66 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|