C15H15N3O3S2 — CID 110827749
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)amino]ethanone (PubChem CID 110827749) has the molecular formula C15H15N3O3S2 and a molecular weight of 349.44 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)amino]ethanone.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)amino]ethanone |
|---|---|
| PubChem CID | 110827749 |
| Molecular Formula | C15H15N3O3S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)amino]ethanone |
| SMILES | C=CCSc1nnc(NCC(=O)c2ccc3c(c2)OCCO3)s1 |
| InChI | InChI=1S/C15H15N3O3S2/c1-2-7-22-15-18-17-14(23-15)16-9-11(19)10-3-4-12-13(8-10)21-6-5-20-12/h2-4,8H,1,5-7,9H2,(H,16,17) |
| InChIKey | BTSXELCAYUBOOU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|