C12H9ClN2O3S — CID 1108281
2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 1108281) has the molecular formula C12H9ClN2O3S and a molecular weight of 296.74 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 1108281 |
| Molecular Formula | C12H9ClN2O3S |
| Molecular Weight | 296.74 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | O=C(CSc1nc(O)cc(=O)[nH]1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H9ClN2O3S/c13-8-3-1-7(2-4-8)9(16)6-19-12-14-10(17)5-11(18)15-12/h1-5H,6H2,(H2,14,15,17,18) |
| InChIKey | ZLEHTGIDTQSUPF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.74 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |