About methyl 1-[9-(1-methylpyridin-1-ium-3-carbonyl)oxynonyl]-5-phenylmethoxyindole-2-carboxylate iodide
methyl 1-[9-(1-methylpyridin-1-ium-3-carbonyl)oxynonyl]-5-phenylmethoxyindole-2-carboxylate iodide (PubChem CID 11082911) has the molecular formula C33H39IN2O5
and a molecular weight of 670.59 g/mol. Its IUPAC name is methyl 1-[9-(1-methylpyridin-1-ium-3-carbonyl)oxynonyl]-5-phenylmethoxyindole-2-carboxylate iodide.
Molecular Properties
| Compound Name | methyl 1-[9-(1-methylpyridin-1-ium-3-carbonyl)oxynonyl]-5-phenylmethoxyindole-2-carboxylate iodide |
| PubChem CID | 11082911 |
| Molecular Formula | C33H39IN2O5 |
| Molecular Weight | 670.59 g/mol |
| Exact Mass | 670.19 |
| IUPAC Name | methyl 1-[9-(1-methylpyridin-1-ium-3-carbonyl)oxynonyl]-5-phenylmethoxyindole-2-carboxylate iodide |
| SMILES | COC(=O)c1cc2cc(OCc3ccccc3)ccc2n1CCCCCCCCCOC(=O)c1ccc[n+](C)c1.[I-] |
| InChI | InChI=1S/C33H39N2O5.HI/c1-34-19-13-16-27(24-34)32(36)39-21-12-7-5-3-4-6-11-20-35-30-18-17-29(40-25-26-14-9-8-10-15-26)22-28(30)23-31(35)33(37)38-2;/h8-10,13-19,22-24H,3-7,11-12,20-21,25H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | QSHWOGALMHCINV-UHFFFAOYSA-M |
| XLogP | 3.42 |
| TPSA | 70.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 670.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[9-(1-methylpyridin-1-ium-3-carbonyl)oxynonyl]-5-phenylmethoxyindole-2-carboxylate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[9-(1-methylpyridin-1-ium-3-carbonyl)oxynonyl]-5-phenylmethoxyindole-2-carboxylate iodide?
The IUPAC name of methyl 1-[9-(1-methylpyridin-1-ium-3-carbonyl)oxynonyl]-5-phenylmethoxyindole-2-carboxylate iodide (CID 11082911) is methyl 1-[9-(1-methylpyridin-1-ium-3-carbonyl)oxynonyl]-5-phenylmethoxyindole-2-carboxylate iodide.
What is the SMILES notation for methyl 1-[9-(1-methylpyridin-1-ium-3-carbonyl)oxynonyl]-5-phenylmethoxyindole-2-carboxylate iodide?
The canonical SMILES for methyl 1-[9-(1-methylpyridin-1-ium-3-carbonyl)oxynonyl]-5-phenylmethoxyindole-2-carboxylate iodide is COC(=O)c1cc2cc(OCc3ccccc3)ccc2n1CCCCCCCCCOC(=O)c1ccc[n+](C)c1.[I-].
What is the InChIKey of methyl 1-[9-(1-methylpyridin-1-ium-3-carbonyl)oxynonyl]-5-phenylmethoxyindole-2-carboxylate iodide?
The InChIKey is QSHWOGALMHCINV-UHFFFAOYSA-M. The full InChI is InChI=1S/C33H39N2O5.HI/c1-34-19-13-16-27(24-34)32(36)39-21-12-7-5-3-4-6-11-20-35-30-18-17-29(40-25-26-14-9-8-10-15-26)22-28(30)23-31(35)33(37)38-2;/h8-10,13-19,22-24H,3-7,11-12,20-21,25H2,1-2H3;1H/q+1;/p-1.
What are the key properties of methyl 1-[9-(1-methylpyridin-1-ium-3-carbonyl)oxynonyl]-5-phenylmethoxyindole-2-carboxylate iodide?
methyl 1-[9-(1-methylpyridin-1-ium-3-carbonyl)oxynonyl]-5-phenylmethoxyindole-2-carboxylate iodide has a molecular weight of 670.59 g/mol, XLogP of 3.42, 15 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[9-(1-methylpyridin-1-ium-3-carbonyl)oxynonyl]-5-phenylmethoxyindole-2-carboxylate iodide is sourced from PubChem (CID 11082911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).