C21H23N3O3S2 — CID 110829148
1-[3-(azepan-1-ylsulfonyl)phenyl]-2-(1,3-benzothiazol-2-ylamino)ethanone (PubChem CID 110829148) has the molecular formula C21H23N3O3S2 and a molecular weight of 429.57 g/mol. Its IUPAC name is 1-[3-(azepan-1-ylsulfonyl)phenyl]-2-(1,3-benzothiazol-2-ylamino)ethanone.
| Compound Name | 1-[3-(azepan-1-ylsulfonyl)phenyl]-2-(1,3-benzothiazol-2-ylamino)ethanone |
|---|---|
| PubChem CID | 110829148 |
| Molecular Formula | C21H23N3O3S2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 1-[3-(azepan-1-ylsulfonyl)phenyl]-2-(1,3-benzothiazol-2-ylamino)ethanone |
| SMILES | O=C(CNc1nc2ccccc2s1)c1cccc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C21H23N3O3S2/c25-19(15-22-21-23-18-10-3-4-11-20(18)28-21)16-8-7-9-17(14-16)29(26,27)24-12-5-1-2-6-13-24/h3-4,7-11,14H,1-2,5-6,12-13,15H2,(H,22,23) |
| InChIKey | DEQLDMQIAXUHKZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |