C40H64O6Si2 — CID 11083022
[(1S,8R,9S,13R)-5-[tert-butyl(dimethyl)silyl]-8-[tert-butyl(dimethyl)silyl]oxy-11-[6-[(4-methoxyphenyl)methoxy]hexyl]-4-oxatricyclo[7.3.1.02,6]trideca-2,5,11-trien-13-yl] acetate (PubChem CID 11083022) has the molecular formula C40H64O6Si2 and a molecular weight of 697.12 g/mol. Its IUPAC name is [(1S,8R,9S,13R)-5-[tert-butyl(dimethyl)silyl]-8-[tert-butyl(dimethyl)silyl]oxy-11-[6-[(4-methoxyphenyl)methoxy]hexyl]-4-oxatricyclo[7.3.1.02,6]trideca-2,5,11-trien-13-yl] acetate.
| Compound Name | [(1S,8R,9S,13R)-5-[tert-butyl(dimethyl)silyl]-8-[tert-butyl(dimethyl)silyl]oxy-11-[6-[(4-methoxyphenyl)methoxy]hexyl]-4-oxatricyclo[7.3.1.02,6]trideca-2,5,11-trien-13-yl] acetate |
|---|---|
| PubChem CID | 11083022 |
| Molecular Formula | C40H64O6Si2 |
| Molecular Weight | 697.12 g/mol |
| Exact Mass | 696.42 |
| IUPAC Name | [(1S,8R,9S,13R)-5-[tert-butyl(dimethyl)silyl]-8-[tert-butyl(dimethyl)silyl]oxy-11-[6-[(4-methoxyphenyl)methoxy]hexyl]-4-oxatricyclo[7.3.1.02,6]trideca-2,5,11-trien-13-yl] acetate |
| SMILES | COc1ccc(COCCCCCCC2=C[C@H]3c4coc([Si](C)(C)C(C)(C)C)c4C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C2)[C@@H]3OC(C)=O)cc1 |
| InChI | InChI=1S/C40H64O6Si2/c1-28(41)45-37-32-23-30(17-15-13-14-16-22-43-26-29-18-20-31(42-8)21-19-29)24-34(37)36(46-48(11,12)40(5,6)7)25-33-35(32)27-44-38(33)47(9,10)39(2,3)4/h18-21,23,27,32,34,36-37H,13-17,22,24-26H2,1-12H3/t32-,34+,36+,37+/m0/s1 |
| InChIKey | LJAFVXJSDKICTN-ZLWLJAEKSA-N |
| XLogP | 10.08 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.12 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|