C18H6Br6 — CID 11083045
2,3,6,7,10,11-hexabromotriphenylene (PubChem CID 11083045) has the molecular formula C18H6Br6 and a molecular weight of 701.67 g/mol. Its IUPAC name is 2,3,6,7,10,11-hexabromotriphenylene.
| Compound Name | 2,3,6,7,10,11-hexabromotriphenylene |
|---|---|
| PubChem CID | 11083045 |
| Molecular Formula | C18H6Br6 |
| Molecular Weight | 701.67 g/mol |
| Exact Mass | 695.56 |
| IUPAC Name | 2,3,6,7,10,11-hexabromotriphenylene |
| SMILES | Brc1cc2c3cc(Br)c(Br)cc3c3cc(Br)c(Br)cc3c2cc1Br |
| InChI | InChI=1S/C18H6Br6/c19-13-1-7-8(2-14(13)20)10-4-17(23)18(24)6-12(10)11-5-16(22)15(21)3-9(7)11/h1-6H |
| InChIKey | GLHQUXLCQLQNPZ-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.67 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|