C21H37NO — CID 110830722
3-[bis(2-methylpropyl)amino]-1-(4-butan-2-ylphenyl)propan-1-ol (PubChem CID 110830722) has the molecular formula C21H37NO and a molecular weight of 319.53 g/mol. Its IUPAC name is 3-[bis(2-methylpropyl)amino]-1-(4-butan-2-ylphenyl)propan-1-ol.
| Compound Name | 3-[bis(2-methylpropyl)amino]-1-(4-butan-2-ylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 110830722 |
| Molecular Formula | C21H37NO |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 319.29 |
| IUPAC Name | 3-[bis(2-methylpropyl)amino]-1-(4-butan-2-ylphenyl)propan-1-ol |
| SMILES | CCC(C)c1ccc(C(O)CCN(CC(C)C)CC(C)C)cc1 |
| InChI | InChI=1S/C21H37NO/c1-7-18(6)19-8-10-20(11-9-19)21(23)12-13-22(14-16(2)3)15-17(4)5/h8-11,16-18,21,23H,7,12-15H2,1-6H3 |
| InChIKey | SBIVXBMXFRTOFH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |