C21H23NO — CID 110831104
1-(3,4-dimethylphenyl)-2-(5-propan-2-ylindol-1-yl)ethanone (PubChem CID 110831104) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-(5-propan-2-ylindol-1-yl)ethanone.
| Compound Name | 1-(3,4-dimethylphenyl)-2-(5-propan-2-ylindol-1-yl)ethanone |
|---|---|
| PubChem CID | 110831104 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-(5-propan-2-ylindol-1-yl)ethanone |
| SMILES | Cc1ccc(C(=O)Cn2ccc3cc(C(C)C)ccc32)cc1C |
| InChI | InChI=1S/C21H23NO/c1-14(2)17-7-8-20-18(12-17)9-10-22(20)13-21(23)19-6-5-15(3)16(4)11-19/h5-12,14H,13H2,1-4H3 |
| InChIKey | PUBBCMCDPROAIW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |