C22H26N2O3 — CID 110831347
2-(4,6-dimethoxyindol-1-yl)-N-(2,4,6-trimethylphenyl)propanamide (PubChem CID 110831347) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-(4,6-dimethoxyindol-1-yl)-N-(2,4,6-trimethylphenyl)propanamide.
| Compound Name | 2-(4,6-dimethoxyindol-1-yl)-N-(2,4,6-trimethylphenyl)propanamide |
|---|---|
| PubChem CID | 110831347 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2-(4,6-dimethoxyindol-1-yl)-N-(2,4,6-trimethylphenyl)propanamide |
| SMILES | COc1cc(OC)c2ccn(C(C)C(=O)Nc3c(C)cc(C)cc3C)c2c1 |
| InChI | InChI=1S/C22H26N2O3/c1-13-9-14(2)21(15(3)10-13)23-22(25)16(4)24-8-7-18-19(24)11-17(26-5)12-20(18)27-6/h7-12,16H,1-6H3,(H,23,25) |
| InChIKey | YTWXDVONAMCMSW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |