About propan-2-yl 2-(6-amino-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate
propan-2-yl 2-(6-amino-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate (PubChem CID 110831753) has the molecular formula C19H21N3O4
and a molecular weight of 355.39 g/mol. Its IUPAC name is propan-2-yl 2-(6-amino-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate.
Molecular Properties
| Compound Name | propan-2-yl 2-(6-amino-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate |
| PubChem CID | 110831753 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | propan-2-yl 2-(6-amino-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate |
| SMILES | CC(C)OC(=O)C(C)N1C(=O)C(c2ccccc2)Oc2ccc(N)nc21 |
| InChI | InChI=1S/C19H21N3O4/c1-11(2)25-19(24)12(3)22-17-14(9-10-15(20)21-17)26-16(18(22)23)13-7-5-4-6-8-13/h4-12,16H,1-3H3,(H2,20,21) |
| InChIKey | JLQOJMCUEHDRFS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze propan-2-yl 2-(6-amino-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-(6-amino-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate?
The IUPAC name of propan-2-yl 2-(6-amino-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate (CID 110831753) is propan-2-yl 2-(6-amino-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate.
What is the SMILES notation for propan-2-yl 2-(6-amino-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate?
The canonical SMILES for propan-2-yl 2-(6-amino-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate is CC(C)OC(=O)C(C)N1C(=O)C(c2ccccc2)Oc2ccc(N)nc21.
What is the InChIKey of propan-2-yl 2-(6-amino-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate?
The InChIKey is JLQOJMCUEHDRFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O4/c1-11(2)25-19(24)12(3)22-17-14(9-10-15(20)21-17)26-16(18(22)23)13-7-5-4-6-8-13/h4-12,16H,1-3H3,(H2,20,21).
What are the key properties of propan-2-yl 2-(6-amino-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate?
propan-2-yl 2-(6-amino-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate has a molecular weight of 355.39 g/mol, XLogP of 2.47, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(6-amino-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate is sourced from PubChem (CID 110831753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).