About ethyl 3-(6-nitro-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate
ethyl 3-(6-nitro-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate (PubChem CID 110831801) has the molecular formula C18H17N3O6
and a molecular weight of 371.35 g/mol. Its IUPAC name is ethyl 3-(6-nitro-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate.
Molecular Properties
| Compound Name | ethyl 3-(6-nitro-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate |
| PubChem CID | 110831801 |
| Molecular Formula | C18H17N3O6 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | ethyl 3-(6-nitro-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate |
| SMILES | CCOC(=O)CCN1C(=O)C(c2ccccc2)Oc2ccc([N+](=O)[O-])nc21 |
| InChI | InChI=1S/C18H17N3O6/c1-2-26-15(22)10-11-20-17-13(8-9-14(19-17)21(24)25)27-16(18(20)23)12-6-4-3-5-7-12/h3-9,16H,2,10-11H2,1H3 |
| InChIKey | PVCHFWIOXXOSEY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 111.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(6-nitro-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(6-nitro-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate?
The IUPAC name of ethyl 3-(6-nitro-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate (CID 110831801) is ethyl 3-(6-nitro-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate.
What is the SMILES notation for ethyl 3-(6-nitro-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate?
The canonical SMILES for ethyl 3-(6-nitro-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate is CCOC(=O)CCN1C(=O)C(c2ccccc2)Oc2ccc([N+](=O)[O-])nc21.
What is the InChIKey of ethyl 3-(6-nitro-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate?
The InChIKey is PVCHFWIOXXOSEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O6/c1-2-26-15(22)10-11-20-17-13(8-9-14(19-17)21(24)25)27-16(18(20)23)12-6-4-3-5-7-12/h3-9,16H,2,10-11H2,1H3.
What are the key properties of ethyl 3-(6-nitro-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate?
ethyl 3-(6-nitro-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate has a molecular weight of 371.35 g/mol, XLogP of 2.41, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(6-nitro-3-oxo-2-phenylpyrido[3,2-b][1,4]oxazin-4-yl)propanoate is sourced from PubChem (CID 110831801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).