C16H12Cl3N3O4 — CID 110831999
2,2-dimethyl-6-nitro-4-[(2,3,6-trichlorophenyl)methyl]pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 110831999) has the molecular formula C16H12Cl3N3O4 and a molecular weight of 416.65 g/mol. Its IUPAC name is 2,2-dimethyl-6-nitro-4-[(2,3,6-trichlorophenyl)methyl]pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 2,2-dimethyl-6-nitro-4-[(2,3,6-trichlorophenyl)methyl]pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 110831999 |
| Molecular Formula | C16H12Cl3N3O4 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | 2,2-dimethyl-6-nitro-4-[(2,3,6-trichlorophenyl)methyl]pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | CC1(C)Oc2ccc([N+](=O)[O-])nc2N(Cc2c(Cl)ccc(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C16H12Cl3N3O4/c1-16(2)15(23)21(7-8-9(17)3-4-10(18)13(8)19)14-11(26-16)5-6-12(20-14)22(24)25/h3-6H,7H2,1-2H3 |
| InChIKey | GRIYTSIEGPWPQQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|