About propan-2-yl 2-(2-oxo-3-propan-2-yl-3,4-dihydroquinoxalin-1-yl)propanoate
propan-2-yl 2-(2-oxo-3-propan-2-yl-3,4-dihydroquinoxalin-1-yl)propanoate (PubChem CID 110832299) has the molecular formula C17H24N2O3
and a molecular weight of 304.39 g/mol. Its IUPAC name is propan-2-yl 2-(2-oxo-3-propan-2-yl-3,4-dihydroquinoxalin-1-yl)propanoate.
Molecular Properties
| Compound Name | propan-2-yl 2-(2-oxo-3-propan-2-yl-3,4-dihydroquinoxalin-1-yl)propanoate |
| PubChem CID | 110832299 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | propan-2-yl 2-(2-oxo-3-propan-2-yl-3,4-dihydroquinoxalin-1-yl)propanoate |
| SMILES | CC(C)OC(=O)C(C)N1C(=O)C(C(C)C)Nc2ccccc21 |
| InChI | InChI=1S/C17H24N2O3/c1-10(2)15-16(20)19(12(5)17(21)22-11(3)4)14-9-7-6-8-13(14)18-15/h6-12,15,18H,1-5H3 |
| InChIKey | UKHFKUJXDXYJPM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-yl 2-(2-oxo-3-propan-2-yl-3,4-dihydroquinoxalin-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-(2-oxo-3-propan-2-yl-3,4-dihydroquinoxalin-1-yl)propanoate?
The IUPAC name of propan-2-yl 2-(2-oxo-3-propan-2-yl-3,4-dihydroquinoxalin-1-yl)propanoate (CID 110832299) is propan-2-yl 2-(2-oxo-3-propan-2-yl-3,4-dihydroquinoxalin-1-yl)propanoate.
What is the SMILES notation for propan-2-yl 2-(2-oxo-3-propan-2-yl-3,4-dihydroquinoxalin-1-yl)propanoate?
The canonical SMILES for propan-2-yl 2-(2-oxo-3-propan-2-yl-3,4-dihydroquinoxalin-1-yl)propanoate is CC(C)OC(=O)C(C)N1C(=O)C(C(C)C)Nc2ccccc21.
What is the InChIKey of propan-2-yl 2-(2-oxo-3-propan-2-yl-3,4-dihydroquinoxalin-1-yl)propanoate?
The InChIKey is UKHFKUJXDXYJPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O3/c1-10(2)15-16(20)19(12(5)17(21)22-11(3)4)14-9-7-6-8-13(14)18-15/h6-12,15,18H,1-5H3.
What are the key properties of propan-2-yl 2-(2-oxo-3-propan-2-yl-3,4-dihydroquinoxalin-1-yl)propanoate?
propan-2-yl 2-(2-oxo-3-propan-2-yl-3,4-dihydroquinoxalin-1-yl)propanoate has a molecular weight of 304.39 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(2-oxo-3-propan-2-yl-3,4-dihydroquinoxalin-1-yl)propanoate is sourced from PubChem (CID 110832299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).