C35H61N5O7SSi3 — CID 11083270
[2-amino-9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl] 4-methylbenzenesulfonate (PubChem CID 11083270) has the molecular formula C35H61N5O7SSi3 and a molecular weight of 780.23 g/mol. Its IUPAC name is [2-amino-9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl] 4-methylbenzenesulfonate.
| Compound Name | [2-amino-9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11083270 |
| Molecular Formula | C35H61N5O7SSi3 |
| Molecular Weight | 780.23 g/mol |
| Exact Mass | 779.36 |
| IUPAC Name | [2-amino-9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2nc(N)nc3c2ncn3[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C35H61N5O7SSi3/c1-23-17-19-24(20-18-23)48(41,42)45-30-26-29(38-32(36)39-30)40(22-37-26)31-28(47-51(15,16)35(8,9)10)27(46-50(13,14)34(5,6)7)25(44-31)21-43-49(11,12)33(2,3)4/h17-20,22,25,27-28,31H,21H2,1-16H3,(H2,36,38,39)/t25-,27-,28-,31-/m1/s1 |
| InChIKey | RELUBRREMOMAGV-QWOIFIOOSA-N |
| XLogP | 8.18 |
| TPSA | 149.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.23 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|