C13H13FN2O3 — CID 110835994
2-[[2-(7-fluoro-1H-indol-3-yl)acetyl]-methylamino]acetic acid (PubChem CID 110835994) has the molecular formula C13H13FN2O3 and a molecular weight of 264.26 g/mol. Its IUPAC name is 2-[[2-(7-fluoro-1H-indol-3-yl)acetyl]-methylamino]acetic acid.
| Compound Name | 2-[[2-(7-fluoro-1H-indol-3-yl)acetyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 110835994 |
| Molecular Formula | C13H13FN2O3 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-[[2-(7-fluoro-1H-indol-3-yl)acetyl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)Cc1c[nH]c2c(F)cccc12 |
| InChI | InChI=1S/C13H13FN2O3/c1-16(7-12(18)19)11(17)5-8-6-15-13-9(8)3-2-4-10(13)14/h2-4,6,15H,5,7H2,1H3,(H,18,19) |
| InChIKey | JXNCRFKVTQLIJF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |