C15H23N3O — CID 110837782
(2R)-2-amino-4-methyl-N-(1-methyl-2,3-dihydroindol-5-yl)pentanamide (PubChem CID 110837782) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is (2R)-2-amino-4-methyl-N-(1-methyl-2,3-dihydroindol-5-yl)pentanamide.
| Compound Name | (2R)-2-amino-4-methyl-N-(1-methyl-2,3-dihydroindol-5-yl)pentanamide |
|---|---|
| PubChem CID | 110837782 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | (2R)-2-amino-4-methyl-N-(1-methyl-2,3-dihydroindol-5-yl)pentanamide |
| SMILES | CC(C)C[C@@H](N)C(=O)Nc1ccc2c(c1)CCN2C |
| InChI | InChI=1S/C15H23N3O/c1-10(2)8-13(16)15(19)17-12-4-5-14-11(9-12)6-7-18(14)3/h4-5,9-10,13H,6-8,16H2,1-3H3,(H,17,19)/t13-/m1/s1 |
| InChIKey | JLJPUSMNKFJAPA-CYBMUJFWSA-N |
| XLogP | 1.99 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|