About 3-[(4,4-dimethylcyclohexyl)-methylamino]-3-methylbutanoic acid
3-[(4,4-dimethylcyclohexyl)-methylamino]-3-methylbutanoic acid (PubChem CID 110838605) has the molecular formula C14H27NO2
and a molecular weight of 241.37 g/mol. Its IUPAC name is 3-[(4,4-dimethylcyclohexyl)-methylamino]-3-methylbutanoic acid.
Analyze 3-[(4,4-dimethylcyclohexyl)-methylamino]-3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,4-dimethylcyclohexyl)-methylamino]-3-methylbutanoic acid?
The IUPAC name of 3-[(4,4-dimethylcyclohexyl)-methylamino]-3-methylbutanoic acid (CID 110838605) is 3-[(4,4-dimethylcyclohexyl)-methylamino]-3-methylbutanoic acid.
What is the SMILES notation for 3-[(4,4-dimethylcyclohexyl)-methylamino]-3-methylbutanoic acid?
The canonical SMILES for 3-[(4,4-dimethylcyclohexyl)-methylamino]-3-methylbutanoic acid is CN(C1CCC(C)(C)CC1)C(C)(C)CC(=O)O.
What is the InChIKey of 3-[(4,4-dimethylcyclohexyl)-methylamino]-3-methylbutanoic acid?
The InChIKey is QTNZKBCHODFXEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO2/c1-13(2)8-6-11(7-9-13)15(5)14(3,4)10-12(16)17/h11H,6-10H2,1-5H3,(H,16,17).
What are the key properties of 3-[(4,4-dimethylcyclohexyl)-methylamino]-3-methylbutanoic acid?
3-[(4,4-dimethylcyclohexyl)-methylamino]-3-methylbutanoic acid has a molecular weight of 241.37 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,4-dimethylcyclohexyl)-methylamino]-3-methylbutanoic acid is sourced from PubChem (CID 110838605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).