C9H10O — CID 11083933
(1R,2S,5R,6S)-tricyclo[4.2.1.02,5]non-7-en-3-one (PubChem CID 11083933) has the molecular formula C9H10O and a molecular weight of 134.18 g/mol. Its IUPAC name is (1R,2S,5R,6S)-tricyclo[4.2.1.02,5]non-7-en-3-one.
| Compound Name | (1R,2S,5R,6S)-tricyclo[4.2.1.02,5]non-7-en-3-one |
|---|---|
| PubChem CID | 11083933 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | (1R,2S,5R,6S)-tricyclo[4.2.1.02,5]non-7-en-3-one |
| SMILES | O=C1C[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C9H10O/c10-8-4-7-5-1-2-6(3-5)9(7)8/h1-2,5-7,9H,3-4H2/t5-,6+,7-,9+/m1/s1 |
| InChIKey | ZHWRWUYPONZDQY-AYHNYZOXSA-N |
| XLogP | 1.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|