About nona-1,8-dien-5-one
nona-1,8-dien-5-one (PubChem CID 11083958) has the molecular formula C9H14O
and a molecular weight of 138.21 g/mol. Its IUPAC name is nona-1,8-dien-5-one.
Molecular Properties
| Compound Name | nona-1,8-dien-5-one |
| PubChem CID | 11083958 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | nona-1,8-dien-5-one |
| SMILES | C=CCCC(=O)CCC=C |
| InChI | InChI=1S/C9H14O/c1-3-5-7-9(10)8-6-4-2/h3-4H,1-2,5-8H2 |
| InChIKey | YMNUETQQDKREEP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze nona-1,8-dien-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nona-1,8-dien-5-one?
The IUPAC name of nona-1,8-dien-5-one (CID 11083958) is nona-1,8-dien-5-one.
What is the SMILES notation for nona-1,8-dien-5-one?
The canonical SMILES for nona-1,8-dien-5-one is C=CCCC(=O)CCC=C.
What is the InChIKey of nona-1,8-dien-5-one?
The InChIKey is YMNUETQQDKREEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O/c1-3-5-7-9(10)8-6-4-2/h3-4H,1-2,5-8H2.
What are the key properties of nona-1,8-dien-5-one?
nona-1,8-dien-5-one has a molecular weight of 138.21 g/mol, XLogP of 2.49, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for nona-1,8-dien-5-one is sourced from PubChem (CID 11083958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).