About 1,2,3,4-tetrafluorobenzene
1,2,3,4-tetrafluorobenzene (PubChem CID 11084) has the molecular formula C6H2F4
and a molecular weight of 150.07 g/mol. Its IUPAC name is 1,2,3,4-tetrafluorobenzene.
Molecular Properties
| Compound Name | 1,2,3,4-tetrafluorobenzene |
| PubChem CID | 11084 |
| Molecular Formula | C6H2F4 |
| Molecular Weight | 150.07 g/mol |
| Exact Mass | 150.01 |
| IUPAC Name | 1,2,3,4-tetrafluorobenzene |
| SMILES | Fc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C6H2F4/c7-3-1-2-4(8)6(10)5(3)9/h1-2H |
| InChIKey | SOZFIIXUNAKEJP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.07 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3,4-tetrafluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,4-tetrafluorobenzene?
The IUPAC name of 1,2,3,4-tetrafluorobenzene (CID 11084) is 1,2,3,4-tetrafluorobenzene.
What is the SMILES notation for 1,2,3,4-tetrafluorobenzene?
The canonical SMILES for 1,2,3,4-tetrafluorobenzene is Fc1ccc(F)c(F)c1F.
What is the InChIKey of 1,2,3,4-tetrafluorobenzene?
The InChIKey is SOZFIIXUNAKEJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2F4/c7-3-1-2-4(8)6(10)5(3)9/h1-2H.
What are the key properties of 1,2,3,4-tetrafluorobenzene?
1,2,3,4-tetrafluorobenzene has a molecular weight of 150.07 g/mol, XLogP of 2.24, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,4-tetrafluorobenzene is sourced from PubChem (CID 11084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).