C7H14O3 — CID 11084020
[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methanol (PubChem CID 11084020) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is [(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 11084020 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | [(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methanol |
| SMILES | C[C@@H]1OC(C)(C)O[C@H]1CO |
| InChI | InChI=1S/C7H14O3/c1-5-6(4-8)10-7(2,3)9-5/h5-6,8H,4H2,1-3H3/t5-,6-/m0/s1 |
| InChIKey | VWUQFWPEGNZUQV-WDSKDSINSA-N |
| XLogP | 0.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |