About 2-oxo-N,N-bis(prop-2-enyl)acetamide
2-oxo-N,N-bis(prop-2-enyl)acetamide (PubChem CID 11084074) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 2-oxo-N,N-bis(prop-2-enyl)acetamide.
Molecular Properties
| Compound Name | 2-oxo-N,N-bis(prop-2-enyl)acetamide |
| PubChem CID | 11084074 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 2-oxo-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)C=O |
| InChI | InChI=1S/C8H11NO2/c1-3-5-9(6-4-2)8(11)7-10/h3-4,7H,1-2,5-6H2 |
| InChIKey | BJHPPDKFNGDTRV-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-N,N-bis(prop-2-enyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-N,N-bis(prop-2-enyl)acetamide?
The IUPAC name of 2-oxo-N,N-bis(prop-2-enyl)acetamide (CID 11084074) is 2-oxo-N,N-bis(prop-2-enyl)acetamide.
What is the SMILES notation for 2-oxo-N,N-bis(prop-2-enyl)acetamide?
The canonical SMILES for 2-oxo-N,N-bis(prop-2-enyl)acetamide is C=CCN(CC=C)C(=O)C=O.
What is the InChIKey of 2-oxo-N,N-bis(prop-2-enyl)acetamide?
The InChIKey is BJHPPDKFNGDTRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-3-5-9(6-4-2)8(11)7-10/h3-4,7H,1-2,5-6H2.
What are the key properties of 2-oxo-N,N-bis(prop-2-enyl)acetamide?
2-oxo-N,N-bis(prop-2-enyl)acetamide has a molecular weight of 153.18 g/mol, XLogP of 0.39, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-N,N-bis(prop-2-enyl)acetamide is sourced from PubChem (CID 11084074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).