C29H24N4O2 — CID 110841357
2-[2-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylidene]hydrazinyl]benzoic acid (PubChem CID 110841357) has the molecular formula C29H24N4O2 and a molecular weight of 460.54 g/mol. Its IUPAC name is 2-[2-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylidene]hydrazinyl]benzoic acid.
| Compound Name | 2-[2-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 110841357 |
| Molecular Formula | C29H24N4O2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 2-[2-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylidene]hydrazinyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1NN=Cc1ccc(N2N=C(c3ccccc3)CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C29H24N4O2/c34-29(35)25-13-7-8-14-26(25)31-30-20-21-15-17-24(18-16-21)33-28(23-11-5-2-6-12-23)19-27(32-33)22-9-3-1-4-10-22/h1-18,20,28,31H,19H2,(H,34,35) |
| InChIKey | GCDJAYRSDZHTTQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_acid_A(19)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|