About [(2S)-3-oxobutan-2-yl] 2,2-dimethylpropanoate
[(2S)-3-oxobutan-2-yl] 2,2-dimethylpropanoate (PubChem CID 11084339) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is [(2S)-3-oxobutan-2-yl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [(2S)-3-oxobutan-2-yl] 2,2-dimethylpropanoate |
| PubChem CID | 11084339 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | [(2S)-3-oxobutan-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(=O)[C@H](C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C9H16O3/c1-6(10)7(2)12-8(11)9(3,4)5/h7H,1-5H3/t7-/m0/s1 |
| InChIKey | RPHBFHBIJHEXIJ-ZETCQYMHSA-N |
| XLogP | 1.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-3-oxobutan-2-yl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-3-oxobutan-2-yl] 2,2-dimethylpropanoate?
The IUPAC name of [(2S)-3-oxobutan-2-yl] 2,2-dimethylpropanoate (CID 11084339) is [(2S)-3-oxobutan-2-yl] 2,2-dimethylpropanoate.
What is the SMILES notation for [(2S)-3-oxobutan-2-yl] 2,2-dimethylpropanoate?
The canonical SMILES for [(2S)-3-oxobutan-2-yl] 2,2-dimethylpropanoate is CC(=O)[C@H](C)OC(=O)C(C)(C)C.
What is the InChIKey of [(2S)-3-oxobutan-2-yl] 2,2-dimethylpropanoate?
The InChIKey is RPHBFHBIJHEXIJ-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H16O3/c1-6(10)7(2)12-8(11)9(3,4)5/h7H,1-5H3/t7-/m0/s1.
What are the key properties of [(2S)-3-oxobutan-2-yl] 2,2-dimethylpropanoate?
[(2S)-3-oxobutan-2-yl] 2,2-dimethylpropanoate has a molecular weight of 172.22 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-3-oxobutan-2-yl] 2,2-dimethylpropanoate is sourced from PubChem (CID 11084339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).