C9H9N3O — CID 11084390
1-(4-methoxyphenyl)-1,2,4-triazole (PubChem CID 11084390) has the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-1,2,4-triazole.
| Compound Name | 1-(4-methoxyphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 11084390 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 1-(4-methoxyphenyl)-1,2,4-triazole |
| SMILES | COc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C9H9N3O/c1-13-9-4-2-8(3-5-9)12-7-10-6-11-12/h2-7H,1H3 |
| InChIKey | HXCCOAUMJBFQCC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |