C17H21BrN2O4 — CID 110844008
ethyl 4-(5-bromo-2-hydroxyphenyl)-6-butyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 110844008) has the molecular formula C17H21BrN2O4 and a molecular weight of 397.27 g/mol. Its IUPAC name is ethyl 4-(5-bromo-2-hydroxyphenyl)-6-butyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(5-bromo-2-hydroxyphenyl)-6-butyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 110844008 |
| Molecular Formula | C17H21BrN2O4 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | ethyl 4-(5-bromo-2-hydroxyphenyl)-6-butyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCCC1=C(C(=O)OCC)C(c2cc(Br)ccc2O)NC(=O)N1 |
| InChI | InChI=1S/C17H21BrN2O4/c1-3-5-6-12-14(16(22)24-4-2)15(20-17(23)19-12)11-9-10(18)7-8-13(11)21/h7-9,15,21H,3-6H2,1-2H3,(H2,19,20,23) |
| InChIKey | CZCRSKFMZLZMSK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|