C25H28N2O5 — CID 110844858
propan-2-yl 4-(4-benzoyloxyphenyl)-6-butyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 110844858) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is propan-2-yl 4-(4-benzoyloxyphenyl)-6-butyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 4-(4-benzoyloxyphenyl)-6-butyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 110844858 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | propan-2-yl 4-(4-benzoyloxyphenyl)-6-butyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCCC1=C(C(=O)OC(C)C)C(c2ccc(OC(=O)c3ccccc3)cc2)NC(=O)N1 |
| InChI | InChI=1S/C25H28N2O5/c1-4-5-11-20-21(24(29)31-16(2)3)22(27-25(30)26-20)17-12-14-19(15-13-17)32-23(28)18-9-7-6-8-10-18/h6-10,12-16,22H,4-5,11H2,1-3H3,(H2,26,27,30) |
| InChIKey | YSJOKCYXPPCVKF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|