C20H27N3O7 — CID 110845478
2-methylpropyl 4-(4-methoxy-2-nitro-5-propoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 110845478) has the molecular formula C20H27N3O7 and a molecular weight of 421.45 g/mol. Its IUPAC name is 2-methylpropyl 4-(4-methoxy-2-nitro-5-propoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | 2-methylpropyl 4-(4-methoxy-2-nitro-5-propoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 110845478 |
| Molecular Formula | C20H27N3O7 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-methylpropyl 4-(4-methoxy-2-nitro-5-propoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCOc1cc(C2NC(=O)NC(C)=C2C(=O)OCC(C)C)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H27N3O7/c1-6-7-29-16-8-13(14(23(26)27)9-15(16)28-5)18-17(12(4)21-20(25)22-18)19(24)30-10-11(2)3/h8-9,11,18H,6-7,10H2,1-5H3,(H2,21,22,25) |
| InChIKey | OHLBRXCIZMUSDP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|