About 2-[(2E,4E)-hexa-2,4-dienyl]benzaldehyde
2-[(2E,4E)-hexa-2,4-dienyl]benzaldehyde (PubChem CID 11084574) has the molecular formula C13H14O
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-[(2E,4E)-hexa-2,4-dienyl]benzaldehyde.
Molecular Properties
| Compound Name | 2-[(2E,4E)-hexa-2,4-dienyl]benzaldehyde |
| PubChem CID | 11084574 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 2-[(2E,4E)-hexa-2,4-dienyl]benzaldehyde |
| SMILES | C/C=C/C=C/Cc1ccccc1C=O |
| InChI | InChI=1S/C13H14O/c1-2-3-4-5-8-12-9-6-7-10-13(12)11-14/h2-7,9-11H,8H2,1H3/b3-2+,5-4+ |
| InChIKey | XNHUFUNRPUBULL-MQQKCMAXSA-N |
| XLogP | 3.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2E,4E)-hexa-2,4-dienyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2E,4E)-hexa-2,4-dienyl]benzaldehyde?
The IUPAC name of 2-[(2E,4E)-hexa-2,4-dienyl]benzaldehyde (CID 11084574) is 2-[(2E,4E)-hexa-2,4-dienyl]benzaldehyde.
What is the SMILES notation for 2-[(2E,4E)-hexa-2,4-dienyl]benzaldehyde?
The canonical SMILES for 2-[(2E,4E)-hexa-2,4-dienyl]benzaldehyde is C/C=C/C=C/Cc1ccccc1C=O.
What is the InChIKey of 2-[(2E,4E)-hexa-2,4-dienyl]benzaldehyde?
The InChIKey is XNHUFUNRPUBULL-MQQKCMAXSA-N. The full InChI is InChI=1S/C13H14O/c1-2-3-4-5-8-12-9-6-7-10-13(12)11-14/h2-7,9-11H,8H2,1H3/b3-2+,5-4+.
What are the key properties of 2-[(2E,4E)-hexa-2,4-dienyl]benzaldehyde?
2-[(2E,4E)-hexa-2,4-dienyl]benzaldehyde has a molecular weight of 186.25 g/mol, XLogP of 3.17, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2E,4E)-hexa-2,4-dienyl]benzaldehyde is sourced from PubChem (CID 11084574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).