C21H19FN2O5 — CID 110845813
methyl 6-ethyl-4-[4-(4-fluorobenzoyl)oxyphenyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 110845813) has the molecular formula C21H19FN2O5 and a molecular weight of 398.39 g/mol. Its IUPAC name is methyl 6-ethyl-4-[4-(4-fluorobenzoyl)oxyphenyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl 6-ethyl-4-[4-(4-fluorobenzoyl)oxyphenyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 110845813 |
| Molecular Formula | C21H19FN2O5 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | methyl 6-ethyl-4-[4-(4-fluorobenzoyl)oxyphenyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCC1=C(C(=O)OC)C(c2ccc(OC(=O)c3ccc(F)cc3)cc2)NC(=O)N1 |
| InChI | InChI=1S/C21H19FN2O5/c1-3-16-17(20(26)28-2)18(24-21(27)23-16)12-6-10-15(11-7-12)29-19(25)13-4-8-14(22)9-5-13/h4-11,18H,3H2,1-2H3,(H2,23,24,27) |
| InChIKey | SKCIXEJDFWCEBQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|