C9H17NO3 — CID 11084587
tert-butyl N-[(1S)-1-(oxiran-2-yl)ethyl]carbamate (PubChem CID 11084587) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(oxiran-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(oxiran-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 11084587 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | tert-butyl N-[(1S)-1-(oxiran-2-yl)ethyl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C1CO1 |
| InChI | InChI=1S/C9H17NO3/c1-6(7-5-12-7)10-8(11)13-9(2,3)4/h6-7H,5H2,1-4H3,(H,10,11)/t6-,7?/m0/s1 |
| InChIKey | CPVJSPZFUWECHS-PKPIPKONSA-N |
| XLogP | 1.30 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|