C9H19NO3 — CID 11084629
(3S,4S,6R)-N-ethyl-4,6-dimethoxyoxan-3-amine (PubChem CID 11084629) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is (3S,4S,6R)-N-ethyl-4,6-dimethoxyoxan-3-amine.
| Compound Name | (3S,4S,6R)-N-ethyl-4,6-dimethoxyoxan-3-amine |
|---|---|
| PubChem CID | 11084629 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | (3S,4S,6R)-N-ethyl-4,6-dimethoxyoxan-3-amine |
| SMILES | CCN[C@H]1CO[C@@H](OC)C[C@@H]1OC |
| InChI | InChI=1S/C9H19NO3/c1-4-10-7-6-13-9(12-3)5-8(7)11-2/h7-10H,4-6H2,1-3H3/t7-,8-,9+/m0/s1 |
| InChIKey | WHILQIMYAXDVDK-XHNCKOQMSA-N |
| XLogP | 0.37 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |