C11H14N2O — CID 11084652
phenyl(1,4,5,6-tetrahydropyrimidin-2-yl)methanol (PubChem CID 11084652) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is phenyl(1,4,5,6-tetrahydropyrimidin-2-yl)methanol.
| Compound Name | phenyl(1,4,5,6-tetrahydropyrimidin-2-yl)methanol |
|---|---|
| PubChem CID | 11084652 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | phenyl(1,4,5,6-tetrahydropyrimidin-2-yl)methanol |
| SMILES | OC(C1=NCCCN1)c1ccccc1 |
| InChI | InChI=1S/C11H14N2O/c14-10(9-5-2-1-3-6-9)11-12-7-4-8-13-11/h1-3,5-6,10,14H,4,7-8H2,(H,12,13) |
| InChIKey | QGDYDKBVTMGYTE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |