C17H20Br2N2O5 — CID 110847414
propan-2-yl 4-(3,5-dibromo-2,4-dihydroxyphenyl)-2-oxo-6-propyl-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 110847414) has the molecular formula C17H20Br2N2O5 and a molecular weight of 492.16 g/mol. Its IUPAC name is propan-2-yl 4-(3,5-dibromo-2,4-dihydroxyphenyl)-2-oxo-6-propyl-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 4-(3,5-dibromo-2,4-dihydroxyphenyl)-2-oxo-6-propyl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 110847414 |
| Molecular Formula | C17H20Br2N2O5 |
| Molecular Weight | 492.16 g/mol |
| Exact Mass | 489.97 |
| IUPAC Name | propan-2-yl 4-(3,5-dibromo-2,4-dihydroxyphenyl)-2-oxo-6-propyl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCC1=C(C(=O)OC(C)C)C(c2cc(Br)c(O)c(Br)c2O)NC(=O)N1 |
| InChI | InChI=1S/C17H20Br2N2O5/c1-4-5-10-11(16(24)26-7(2)3)13(21-17(25)20-10)8-6-9(18)15(23)12(19)14(8)22/h6-7,13,22-23H,4-5H2,1-3H3,(H2,20,21,25) |
| InChIKey | ASFQKUFTJWJVKR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.16 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|