About tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate
tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate (PubChem CID 11084836) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate |
| PubChem CID | 11084836 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C=C[C@@H](O)C1 |
| InChI | InChI=1S/C10H17NO3/c1-10(2,3)14-9(13)11-7-4-5-8(12)6-7/h4-5,7-8,12H,6H2,1-3H3,(H,11,13)/t7-,8+/m0/s1 |
| InChIKey | UWWUTEZECIYOCW-JGVFFNPUSA-N |
| XLogP | 1.20 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate?
The IUPAC name of tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate (CID 11084836) is tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate?
The canonical SMILES for tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate is CC(C)(C)OC(=O)N[C@H]1C=C[C@@H](O)C1.
What is the InChIKey of tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate?
The InChIKey is UWWUTEZECIYOCW-JGVFFNPUSA-N. The full InChI is InChI=1S/C10H17NO3/c1-10(2,3)14-9(13)11-7-4-5-8(12)6-7/h4-5,7-8,12H,6H2,1-3H3,(H,11,13)/t7-,8+/m0/s1.
What are the key properties of tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate?
tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate has a molecular weight of 199.25 g/mol, XLogP of 1.20, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate is sourced from PubChem (CID 11084836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).