C11H14N4O — CID 110848509
N-butan-2-yl-1H-imidazo[4,5-b]pyridine-6-carboxamide (PubChem CID 110848509) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is N-butan-2-yl-1H-imidazo[4,5-b]pyridine-6-carboxamide.
| Compound Name | N-butan-2-yl-1H-imidazo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 110848509 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | N-butan-2-yl-1H-imidazo[4,5-b]pyridine-6-carboxamide |
| SMILES | CCC(C)NC(=O)c1cnc2nc[nH]c2c1 |
| InChI | InChI=1S/C11H14N4O/c1-3-7(2)15-11(16)8-4-9-10(12-5-8)14-6-13-9/h4-7H,3H2,1-2H3,(H,15,16)(H,12,13,14) |
| InChIKey | ABSXGRLQTMPWMA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |