C20H24N2OS3 — CID 1108487
2-piperidin-1-yl-1-(4,4,8-trimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)ethanone (PubChem CID 1108487) has the molecular formula C20H24N2OS3 and a molecular weight of 404.63 g/mol. Its IUPAC name is 2-piperidin-1-yl-1-(4,4,8-trimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)ethanone.
| Compound Name | 2-piperidin-1-yl-1-(4,4,8-trimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)ethanone |
|---|---|
| PubChem CID | 1108487 |
| Molecular Formula | C20H24N2OS3 |
| Molecular Weight | 404.63 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-piperidin-1-yl-1-(4,4,8-trimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)ethanone |
| SMILES | Cc1ccc2c(c1)-c1c(ssc1=S)C(C)(C)N2C(=O)CN1CCCCC1 |
| InChI | InChI=1S/C20H24N2OS3/c1-13-7-8-15-14(11-13)17-18(25-26-19(17)24)20(2,3)22(15)16(23)12-21-9-5-4-6-10-21/h7-8,11H,4-6,9-10,12H2,1-3H3 |
| InChIKey | XOSZHUXUZBXQIY-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.63 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|