C17H20N2O — CID 110848885
2-(3-methylquinolin-2-yl)-1-piperidin-1-ylethanone (PubChem CID 110848885) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-(3-methylquinolin-2-yl)-1-piperidin-1-ylethanone.
| Compound Name | 2-(3-methylquinolin-2-yl)-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 110848885 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-(3-methylquinolin-2-yl)-1-piperidin-1-ylethanone |
| SMILES | Cc1cc2ccccc2nc1CC(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H20N2O/c1-13-11-14-7-3-4-8-15(14)18-16(13)12-17(20)19-9-5-2-6-10-19/h3-4,7-8,11H,2,5-6,9-10,12H2,1H3 |
| InChIKey | GYSRVFQBNSRJCZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |