C8H11N3O3 — CID 110849278
N-(2-methoxyethyl)-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 110849278) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is N-(2-methoxyethyl)-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(2-methoxyethyl)-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 110849278 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | N-(2-methoxyethyl)-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | COCCNC(=O)c1cnc[nH]c1=O |
| InChI | InChI=1S/C8H11N3O3/c1-14-3-2-10-7(12)6-4-9-5-11-8(6)13/h4-5H,2-3H2,1H3,(H,10,12)(H,9,11,13) |
| InChIKey | ZODAELQSCYBEFO-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|