C11H15N3O2S — CID 110850068
4-(2,5-dimethyl-1,3-thiazole-4-carbonyl)piperazine-1-carbaldehyde (PubChem CID 110850068) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is 4-(2,5-dimethyl-1,3-thiazole-4-carbonyl)piperazine-1-carbaldehyde.
| Compound Name | 4-(2,5-dimethyl-1,3-thiazole-4-carbonyl)piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 110850068 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-(2,5-dimethyl-1,3-thiazole-4-carbonyl)piperazine-1-carbaldehyde |
| SMILES | Cc1nc(C(=O)N2CCN(C=O)CC2)c(C)s1 |
| InChI | InChI=1S/C11H15N3O2S/c1-8-10(12-9(2)17-8)11(16)14-5-3-13(7-15)4-6-14/h7H,3-6H2,1-2H3 |
| InChIKey | VUFBEZWVRDLVBF-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|