C13H21NO — CID 11085035
(4aS,8S)-8-methyl-2-propyl-4a,5,6,7,8,8a-hexahydro-1H-quinolin-4-one (PubChem CID 11085035) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (4aS,8S)-8-methyl-2-propyl-4a,5,6,7,8,8a-hexahydro-1H-quinolin-4-one.
| Compound Name | (4aS,8S)-8-methyl-2-propyl-4a,5,6,7,8,8a-hexahydro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 11085035 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (4aS,8S)-8-methyl-2-propyl-4a,5,6,7,8,8a-hexahydro-1H-quinolin-4-one |
| SMILES | CCCC1=CC(=O)[C@H]2CCC[C@H](C)C2N1 |
| InChI | InChI=1S/C13H21NO/c1-3-5-10-8-12(15)11-7-4-6-9(2)13(11)14-10/h8-9,11,13-14H,3-7H2,1-2H3/t9-,11+,13?/m0/s1 |
| InChIKey | XPUVTPJPEKNQQM-QQTYBIEJSA-N |
| XLogP | 2.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |