C13H17NOS — CID 110850879
N-[(4-methylphenyl)methyl]thiolane-2-carboxamide (PubChem CID 110850879) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]thiolane-2-carboxamide.
| Compound Name | N-[(4-methylphenyl)methyl]thiolane-2-carboxamide |
|---|---|
| PubChem CID | 110850879 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | N-[(4-methylphenyl)methyl]thiolane-2-carboxamide |
| SMILES | Cc1ccc(CNC(=O)C2CCCS2)cc1 |
| InChI | InChI=1S/C13H17NOS/c1-10-4-6-11(7-5-10)9-14-13(15)12-3-2-8-16-12/h4-7,12H,2-3,8-9H2,1H3,(H,14,15) |
| InChIKey | OXCQRJODVINFDE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |