About (2,5-dioxopyrrolidin-1-yl) 2-acetamidoacetate
(2,5-dioxopyrrolidin-1-yl) 2-acetamidoacetate (PubChem CID 11085151) has the molecular formula C8H10N2O5
and a molecular weight of 214.18 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-acetamidoacetate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-acetamidoacetate |
| PubChem CID | 11085151 |
| Molecular Formula | C8H10N2O5 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-acetamidoacetate |
| SMILES | CC(=O)NCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C8H10N2O5/c1-5(11)9-4-8(14)15-10-6(12)2-3-7(10)13/h2-4H2,1H3,(H,9,11) |
| InChIKey | YLVAAZXLYPUDRS-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 2-acetamidoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 2-acetamidoacetate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 2-acetamidoacetate (CID 11085151) is (2,5-dioxopyrrolidin-1-yl) 2-acetamidoacetate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 2-acetamidoacetate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 2-acetamidoacetate is CC(=O)NCC(=O)ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 2-acetamidoacetate?
The InChIKey is YLVAAZXLYPUDRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O5/c1-5(11)9-4-8(14)15-10-6(12)2-3-7(10)13/h2-4H2,1H3,(H,9,11).
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 2-acetamidoacetate?
(2,5-dioxopyrrolidin-1-yl) 2-acetamidoacetate has a molecular weight of 214.18 g/mol, XLogP of -1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 2-acetamidoacetate is sourced from PubChem (CID 11085151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).