C14H13N3O — CID 110852369
3,4-dihydro-1H-isoquinolin-2-yl(pyridazin-3-yl)methanone (PubChem CID 110852369) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is 3,4-dihydro-1H-isoquinolin-2-yl(pyridazin-3-yl)methanone.
| Compound Name | 3,4-dihydro-1H-isoquinolin-2-yl(pyridazin-3-yl)methanone |
|---|---|
| PubChem CID | 110852369 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 3,4-dihydro-1H-isoquinolin-2-yl(pyridazin-3-yl)methanone |
| SMILES | O=C(c1cccnn1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C14H13N3O/c18-14(13-6-3-8-15-16-13)17-9-7-11-4-1-2-5-12(11)10-17/h1-6,8H,7,9-10H2 |
| InChIKey | HRJCLSIKHNVFFR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |