C11H15N3O3S — CID 110852773
N-(1,1-dioxothiolan-3-yl)-2,6-dimethylpyrimidine-4-carboxamide (PubChem CID 110852773) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2,6-dimethylpyrimidine-4-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2,6-dimethylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 110852773 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2,6-dimethylpyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCS(=O)(=O)C2)nc(C)n1 |
| InChI | InChI=1S/C11H15N3O3S/c1-7-5-10(13-8(2)12-7)11(15)14-9-3-4-18(16,17)6-9/h5,9H,3-4,6H2,1-2H3,(H,14,15) |
| InChIKey | HOHAVOYMAFDATR-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |