C12H12O4 — CID 11085316
(8aS,8bS)-8b-ethenyl-3a,4,8,8a-tetrahydro-3H-furo[3,4-e][2]benzofuran-1,6-dione (PubChem CID 11085316) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is (8aS,8bS)-8b-ethenyl-3a,4,8,8a-tetrahydro-3H-furo[3,4-e][2]benzofuran-1,6-dione.
| Compound Name | (8aS,8bS)-8b-ethenyl-3a,4,8,8a-tetrahydro-3H-furo[3,4-e][2]benzofuran-1,6-dione |
|---|---|
| PubChem CID | 11085316 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (8aS,8bS)-8b-ethenyl-3a,4,8,8a-tetrahydro-3H-furo[3,4-e][2]benzofuran-1,6-dione |
| SMILES | C=C[C@]12C(=O)OCC1CC=C1C(=O)OC[C@@H]12 |
| InChI | InChI=1S/C12H12O4/c1-2-12-7(5-16-11(12)14)3-4-8-9(12)6-15-10(8)13/h2,4,7,9H,1,3,5-6H2/t7?,9-,12-/m0/s1 |
| InChIKey | MPTZILSKBPXKAD-RONJSDBNSA-N |
| XLogP | 0.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|