C18H27FN4O — CID 110853267
1-[4-(4-fluorophenyl)piperazin-1-yl]-3-(4-methylpiperazin-1-yl)propan-1-one (PubChem CID 110853267) has the molecular formula C18H27FN4O and a molecular weight of 334.44 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)piperazin-1-yl]-3-(4-methylpiperazin-1-yl)propan-1-one.
| Compound Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-3-(4-methylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 110853267 |
| Molecular Formula | C18H27FN4O |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-3-(4-methylpiperazin-1-yl)propan-1-one |
| SMILES | CN1CCN(CCC(=O)N2CCN(c3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C18H27FN4O/c1-20-8-10-21(11-9-20)7-6-18(24)23-14-12-22(13-15-23)17-4-2-16(19)3-5-17/h2-5H,6-15H2,1H3 |
| InChIKey | UPVSDLZNJSXNNA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |