C16H16ClN3O2 — CID 110854505
[4-(3-chlorophenyl)piperazin-1-yl]-(5-hydroxy-3-pyridinyl)methanone (PubChem CID 110854505) has the molecular formula C16H16ClN3O2 and a molecular weight of 317.78 g/mol. Its IUPAC name is [4-(3-chlorophenyl)piperazin-1-yl]-(5-hydroxy-3-pyridinyl)methanone.
| Compound Name | [4-(3-chlorophenyl)piperazin-1-yl]-(5-hydroxy-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 110854505 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | [4-(3-chlorophenyl)piperazin-1-yl]-(5-hydroxy-3-pyridinyl)methanone |
| SMILES | O=C(c1cncc(O)c1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C16H16ClN3O2/c17-13-2-1-3-14(9-13)19-4-6-20(7-5-19)16(22)12-8-15(21)11-18-10-12/h1-3,8-11,21H,4-7H2 |
| InChIKey | KTPSBKXWXUPGKY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |